C22H22N2O6S2 — CID 55827287
3-(benzenesulfonylmethyl)-N-[3-(methanesulfonamido)-4-methoxyphenyl]benzamide (PubChem CID 55827287) has the molecular formula C22H22N2O6S2 and a molecular weight of 474.56 g/mol. Its IUPAC name is 3-(benzenesulfonylmethyl)-N-[3-(methanesulfonamido)-4-methoxyphenyl]benzamide.
| Compound Name | 3-(benzenesulfonylmethyl)-N-[3-(methanesulfonamido)-4-methoxyphenyl]benzamide |
|---|---|
| PubChem CID | 55827287 |
| Molecular Formula | C22H22N2O6S2 |
| Molecular Weight | 474.56 g/mol |
| Exact Mass | 474.09 |
| IUPAC Name | 3-(benzenesulfonylmethyl)-N-[3-(methanesulfonamido)-4-methoxyphenyl]benzamide |
| SMILES | COc1ccc(NC(=O)c2cccc(CS(=O)(=O)c3ccccc3)c2)cc1NS(C)(=O)=O |
| InChI | InChI=1S/C22H22N2O6S2/c1-30-21-12-11-18(14-20(21)24-31(2,26)27)23-22(25)17-8-6-7-16(13-17)15-32(28,29)19-9-4-3-5-10-19/h3-14,24H,15H2,1-2H3,(H,23,25) |
| InChIKey | PWYKXLNVAYAJDB-UHFFFAOYSA-N |
| XLogP | 3.29 |
| TPSA | 118.64 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 474.56 |
| LogP ≤ 5 | 3.29 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |