C18H17N3O4S — CID 52788633
N-[3-(methanesulfonamido)-4-methoxyphenyl]isoquinoline-1-carboxamide (PubChem CID 52788633) has the molecular formula C18H17N3O4S and a molecular weight of 371.42 g/mol. Its IUPAC name is N-[3-(methanesulfonamido)-4-methoxyphenyl]isoquinoline-1-carboxamide.
| Compound Name | N-[3-(methanesulfonamido)-4-methoxyphenyl]isoquinoline-1-carboxamide |
|---|---|
| PubChem CID | 52788633 |
| Molecular Formula | C18H17N3O4S |
| Molecular Weight | 371.42 g/mol |
| Exact Mass | 371.09 |
| IUPAC Name | N-[3-(methanesulfonamido)-4-methoxyphenyl]isoquinoline-1-carboxamide |
| SMILES | COc1ccc(NC(=O)c2nccc3ccccc23)cc1NS(C)(=O)=O |
| InChI | InChI=1S/C18H17N3O4S/c1-25-16-8-7-13(11-15(16)21-26(2,23)24)20-18(22)17-14-6-4-3-5-12(14)9-10-19-17/h3-11,21H,1-2H3,(H,20,22) |
| InChIKey | SZOJRARRTDWIND-UHFFFAOYSA-N |
| XLogP | 2.87 |
| TPSA | 97.39 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 371.42 |
| LogP ≤ 5 | 2.87 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |