C17H18F2N2O6S — CID 37065204
4-(difluoromethoxy)-N-[3-(methanesulfonamido)-4-methoxyphenyl]-3-methoxybenzamide (PubChem CID 37065204) has the molecular formula C17H18F2N2O6S and a molecular weight of 416.40 g/mol. Its IUPAC name is 4-(difluoromethoxy)-N-[3-(methanesulfonamido)-4-methoxyphenyl]-3-methoxybenzamide.
| Compound Name | 4-(difluoromethoxy)-N-[3-(methanesulfonamido)-4-methoxyphenyl]-3-methoxybenzamide |
|---|---|
| PubChem CID | 37065204 |
| Molecular Formula | C17H18F2N2O6S |
| Molecular Weight | 416.40 g/mol |
| Exact Mass | 416.09 |
| IUPAC Name | 4-(difluoromethoxy)-N-[3-(methanesulfonamido)-4-methoxyphenyl]-3-methoxybenzamide |
| SMILES | COc1ccc(NC(=O)c2ccc(OC(F)F)c(OC)c2)cc1NS(C)(=O)=O |
| InChI | InChI=1S/C17H18F2N2O6S/c1-25-13-7-5-11(9-12(13)21-28(3,23)24)20-16(22)10-4-6-14(27-17(18)19)15(8-10)26-2/h4-9,17,21H,1-3H3,(H,20,22) |
| InChIKey | ALFKNAATNONMJD-UHFFFAOYSA-N |
| XLogP | 2.93 |
| TPSA | 102.96 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 416.40 |
| LogP ≤ 5 | 2.93 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |