C18H19F2N3O6S — CID 56516233
5-acetamido-N-[3-(difluoromethoxy)-4-methoxyphenyl]-2-(methanesulfonamido)benzamide (PubChem CID 56516233) has the molecular formula C18H19F2N3O6S and a molecular weight of 443.43 g/mol. Its IUPAC name is 5-acetamido-N-[3-(difluoromethoxy)-4-methoxyphenyl]-2-(methanesulfonamido)benzamide.
| Compound Name | 5-acetamido-N-[3-(difluoromethoxy)-4-methoxyphenyl]-2-(methanesulfonamido)benzamide |
|---|---|
| PubChem CID | 56516233 |
| Molecular Formula | C18H19F2N3O6S |
| Molecular Weight | 443.43 g/mol |
| Exact Mass | 443.10 |
| IUPAC Name | 5-acetamido-N-[3-(difluoromethoxy)-4-methoxyphenyl]-2-(methanesulfonamido)benzamide |
| SMILES | COc1ccc(NC(=O)c2cc(NC(C)=O)ccc2NS(C)(=O)=O)cc1OC(F)F |
| InChI | InChI=1S/C18H19F2N3O6S/c1-10(24)21-11-4-6-14(23-30(3,26)27)13(8-11)17(25)22-12-5-7-15(28-2)16(9-12)29-18(19)20/h4-9,18,23H,1-3H3,(H,21,24)(H,22,25) |
| InChIKey | LMDGIQKOMKYLPB-UHFFFAOYSA-N |
| XLogP | 2.88 |
| TPSA | 122.83 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 443.43 |
| LogP ≤ 5 | 2.88 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |