C15H14F2N2O4S — CID 51166116
N-[4-(difluoromethoxy)phenyl]-2-(methanesulfonamido)benzamide (PubChem CID 51166116) has the molecular formula C15H14F2N2O4S and a molecular weight of 356.35 g/mol. Its IUPAC name is N-[4-(difluoromethoxy)phenyl]-2-(methanesulfonamido)benzamide.
| Compound Name | N-[4-(difluoromethoxy)phenyl]-2-(methanesulfonamido)benzamide |
|---|---|
| PubChem CID | 51166116 |
| Molecular Formula | C15H14F2N2O4S |
| Molecular Weight | 356.35 g/mol |
| Exact Mass | 356.06 |
| IUPAC Name | N-[4-(difluoromethoxy)phenyl]-2-(methanesulfonamido)benzamide |
| SMILES | CS(=O)(=O)Nc1ccccc1C(=O)Nc1ccc(OC(F)F)cc1 |
| InChI | InChI=1S/C15H14F2N2O4S/c1-24(21,22)19-13-5-3-2-4-12(13)14(20)18-10-6-8-11(9-7-10)23-15(16)17/h2-9,15,19H,1H3,(H,18,20) |
| InChIKey | SAUZCKHQLYOWNG-UHFFFAOYSA-N |
| XLogP | 2.91 |
| TPSA | 84.50 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 356.35 |
| LogP ≤ 5 | 2.91 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |