C23H25N3O3S2 — CID 47092673
N-(2-propyl-1,3-dihydroisoindol-5-yl)-3-(thiophen-2-ylmethylsulfamoyl)benzamide (PubChem CID 47092673) has the molecular formula C23H25N3O3S2 and a molecular weight of 455.61 g/mol. Its IUPAC name is N-(2-propyl-1,3-dihydroisoindol-5-yl)-3-(thiophen-2-ylmethylsulfamoyl)benzamide.
| Compound Name | N-(2-propyl-1,3-dihydroisoindol-5-yl)-3-(thiophen-2-ylmethylsulfamoyl)benzamide |
|---|---|
| PubChem CID | 47092673 |
| Molecular Formula | C23H25N3O3S2 |
| Molecular Weight | 455.61 g/mol |
| Exact Mass | 455.13 |
| IUPAC Name | N-(2-propyl-1,3-dihydroisoindol-5-yl)-3-(thiophen-2-ylmethylsulfamoyl)benzamide |
| SMILES | CCCN1Cc2ccc(NC(=O)c3cccc(S(=O)(=O)NCc4cccs4)c3)cc2C1 |
| InChI | InChI=1S/C23H25N3O3S2/c1-2-10-26-15-18-8-9-20(12-19(18)16-26)25-23(27)17-5-3-7-22(13-17)31(28,29)24-14-21-6-4-11-30-21/h3-9,11-13,24H,2,10,14-16H2,1H3,(H,25,27) |
| InChIKey | WQDTZGHACSSRMB-UHFFFAOYSA-N |
| XLogP | 4.20 |
| TPSA | 78.51 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 455.61 |
| LogP ≤ 5 | 4.20 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |