C27H18Cl3N3O6 — CID 57074099
1-N,3-N,5-N-tris(5-chloro-2-hydroxyphenyl)benzene-1,3,5-tricarboxamide (PubChem CID 57074099) has the molecular formula C27H18Cl3N3O6 and a molecular weight of 586.82 g/mol. Its IUPAC name is 1-N,3-N,5-N-tris(5-chloro-2-hydroxyphenyl)benzene-1,3,5-tricarboxamide.
| Compound Name | 1-N,3-N,5-N-tris(5-chloro-2-hydroxyphenyl)benzene-1,3,5-tricarboxamide |
|---|---|
| PubChem CID | 57074099 |
| Molecular Formula | C27H18Cl3N3O6 |
| Molecular Weight | 586.82 g/mol |
| Exact Mass | 585.03 |
| IUPAC Name | 1-N,3-N,5-N-tris(5-chloro-2-hydroxyphenyl)benzene-1,3,5-tricarboxamide |
| SMILES | O=C(Nc1cc(Cl)ccc1O)c1cc(C(=O)Nc2cc(Cl)ccc2O)cc(C(=O)Nc2cc(Cl)ccc2O)c1 |
| InChI | InChI=1S/C27H18Cl3N3O6/c28-16-1-4-22(34)19(10-16)31-25(37)13-7-14(26(38)32-20-11-17(29)2-5-23(20)35)9-15(8-13)27(39)33-21-12-18(30)3-6-24(21)36/h1-12,34-36H,(H,31,37)(H,32,38)(H,33,39) |
| InChIKey | ZHJVPLGCCBKQMP-UHFFFAOYSA-N |
| XLogP | 6.52 |
| TPSA | 147.99 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 39 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 586.82 |
| LogP ≤ 5 | 6.52 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'catechol', 'substructure': 'N/A'} |
|---|