C10H8ClN3O2 — CID 16678665
N-(5-chloro-2-hydroxyphenyl)-1H-pyrazole-5-carboxamide (PubChem CID 16678665) has the molecular formula C10H8ClN3O2 and a molecular weight of 237.65 g/mol. Its IUPAC name is N-(5-chloro-2-hydroxyphenyl)-1H-pyrazole-5-carboxamide.
| Compound Name | N-(5-chloro-2-hydroxyphenyl)-1H-pyrazole-5-carboxamide |
|---|---|
| PubChem CID | 16678665 |
| Molecular Formula | C10H8ClN3O2 |
| Molecular Weight | 237.65 g/mol |
| Exact Mass | 237.03 |
| IUPAC Name | N-(5-chloro-2-hydroxyphenyl)-1H-pyrazole-5-carboxamide |
| SMILES | O=C(Nc1cc(Cl)ccc1O)c1ccn[nH]1 |
| InChI | InChI=1S/C10H8ClN3O2/c11-6-1-2-9(15)8(5-6)13-10(16)7-3-4-12-14-7/h1-5,15H,(H,12,14)(H,13,16) |
| InChIKey | VITDPRJPSXGSFO-UHFFFAOYSA-N |
| XLogP | 2.02 |
| TPSA | 78.01 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 237.65 |
| LogP ≤ 5 | 2.02 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'catechol', 'substructure': 'N/A'} |
|---|