C10H7BrClN3O2 — CID 19511215
4-bromo-N-(5-chloro-2-hydroxyphenyl)-1H-pyrazole-5-carboxamide (PubChem CID 19511215) has the molecular formula C10H7BrClN3O2 and a molecular weight of 316.54 g/mol. Its IUPAC name is 4-bromo-N-(5-chloro-2-hydroxyphenyl)-1H-pyrazole-5-carboxamide.
| Compound Name | 4-bromo-N-(5-chloro-2-hydroxyphenyl)-1H-pyrazole-5-carboxamide |
|---|---|
| PubChem CID | 19511215 |
| Molecular Formula | C10H7BrClN3O2 |
| Molecular Weight | 316.54 g/mol |
| Exact Mass | 314.94 |
| IUPAC Name | 4-bromo-N-(5-chloro-2-hydroxyphenyl)-1H-pyrazole-5-carboxamide |
| SMILES | O=C(Nc1cc(Cl)ccc1O)c1[nH]ncc1Br |
| InChI | InChI=1S/C10H7BrClN3O2/c11-6-4-13-15-9(6)10(17)14-7-3-5(12)1-2-8(7)16/h1-4,16H,(H,13,15)(H,14,17) |
| InChIKey | KRNPSPDLAKIHQU-UHFFFAOYSA-N |
| XLogP | 2.78 |
| TPSA | 78.01 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 316.54 |
| LogP ≤ 5 | 2.78 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'catechol', 'substructure': 'N/A'} |
|---|