C9H6ClN3O2S — CID 12639723
N-(5-chloro-2-hydroxyphenyl)-1,3,4-thiadiazole-2-carboxamide (PubChem CID 12639723) has the molecular formula C9H6ClN3O2S and a molecular weight of 255.69 g/mol. Its IUPAC name is N-(5-chloro-2-hydroxyphenyl)-1,3,4-thiadiazole-2-carboxamide.
| Compound Name | N-(5-chloro-2-hydroxyphenyl)-1,3,4-thiadiazole-2-carboxamide |
|---|---|
| PubChem CID | 12639723 |
| Molecular Formula | C9H6ClN3O2S |
| Molecular Weight | 255.69 g/mol |
| Exact Mass | 254.99 |
| IUPAC Name | N-(5-chloro-2-hydroxyphenyl)-1,3,4-thiadiazole-2-carboxamide |
| SMILES | O=C(Nc1cc(Cl)ccc1O)c1nncs1 |
| InChI | InChI=1S/C9H6ClN3O2S/c10-5-1-2-7(14)6(3-5)12-8(15)9-13-11-4-16-9/h1-4,14H,(H,12,15) |
| InChIKey | YWATUUWFJFIDIU-UHFFFAOYSA-N |
| XLogP | 2.15 |
| TPSA | 75.11 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 255.69 |
| LogP ≤ 5 | 2.15 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'catechol', 'substructure': 'N/A'} |
|---|