C10H8ClN5O3 — CID 108519080
N-(5-chloro-2-hydroxyphenyl)-N'-(1,2,4-triazol-4-yl)oxamide (PubChem CID 108519080) has the molecular formula C10H8ClN5O3 and a molecular weight of 281.66 g/mol. Its IUPAC name is N-(5-chloro-2-hydroxyphenyl)-N'-(1,2,4-triazol-4-yl)oxamide.
| Compound Name | N-(5-chloro-2-hydroxyphenyl)-N'-(1,2,4-triazol-4-yl)oxamide |
|---|---|
| PubChem CID | 108519080 |
| Molecular Formula | C10H8ClN5O3 |
| Molecular Weight | 281.66 g/mol |
| Exact Mass | 281.03 |
| IUPAC Name | N-(5-chloro-2-hydroxyphenyl)-N'-(1,2,4-triazol-4-yl)oxamide |
| SMILES | O=C(Nc1cc(Cl)ccc1O)C(=O)Nn1cnnc1 |
| InChI | InChI=1S/C10H8ClN5O3/c11-6-1-2-8(17)7(3-6)14-9(18)10(19)15-16-4-12-13-5-16/h1-5,17H,(H,14,18)(H,15,19) |
| InChIKey | IGEBBDZWUZILCP-UHFFFAOYSA-N |
| XLogP | 0.35 |
| TPSA | 109.14 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 281.66 |
| LogP ≤ 5 | 0.35 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'catechol', 'substructure': 'N/A'}, {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|