C15H12ClN3O4 — CID 108519760
N'-(4-aminobenzoyl)-N-(5-chloro-2-hydroxyphenyl)oxamide (PubChem CID 108519760) has the molecular formula C15H12ClN3O4 and a molecular weight of 333.73 g/mol. Its IUPAC name is N'-(4-aminobenzoyl)-N-(5-chloro-2-hydroxyphenyl)oxamide.
| Compound Name | N'-(4-aminobenzoyl)-N-(5-chloro-2-hydroxyphenyl)oxamide |
|---|---|
| PubChem CID | 108519760 |
| Molecular Formula | C15H12ClN3O4 |
| Molecular Weight | 333.73 g/mol |
| Exact Mass | 333.05 |
| IUPAC Name | N'-(4-aminobenzoyl)-N-(5-chloro-2-hydroxyphenyl)oxamide |
| SMILES | Nc1ccc(C(=O)NC(=O)C(=O)Nc2cc(Cl)ccc2O)cc1 |
| InChI | InChI=1S/C15H12ClN3O4/c16-9-3-6-12(20)11(7-9)18-14(22)15(23)19-13(21)8-1-4-10(17)5-2-8/h1-7,20H,17H2,(H,18,22)(H,19,21,23) |
| InChIKey | ICSLBIMJWRKPTE-UHFFFAOYSA-N |
| XLogP | 1.52 |
| TPSA | 121.52 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 333.73 |
| LogP ≤ 5 | 1.52 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'catechol', 'substructure': 'N/A'}, {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|