C14H12ClN3O5S — CID 108508697
N'-(5-chloro-2-hydroxyphenyl)-N-(4-sulfamoylphenyl)oxamide (PubChem CID 108508697) has the molecular formula C14H12ClN3O5S and a molecular weight of 369.79 g/mol. Its IUPAC name is N'-(5-chloro-2-hydroxyphenyl)-N-(4-sulfamoylphenyl)oxamide.
| Compound Name | N'-(5-chloro-2-hydroxyphenyl)-N-(4-sulfamoylphenyl)oxamide |
|---|---|
| PubChem CID | 108508697 |
| Molecular Formula | C14H12ClN3O5S |
| Molecular Weight | 369.79 g/mol |
| Exact Mass | 369.02 |
| IUPAC Name | N'-(5-chloro-2-hydroxyphenyl)-N-(4-sulfamoylphenyl)oxamide |
| SMILES | NS(=O)(=O)c1ccc(NC(=O)C(=O)Nc2cc(Cl)ccc2O)cc1 |
| InChI | InChI=1S/C14H12ClN3O5S/c15-8-1-6-12(19)11(7-8)18-14(21)13(20)17-9-2-4-10(5-3-9)24(16,22)23/h1-7,19H,(H,17,20)(H,18,21)(H2,16,22,23) |
| InChIKey | AFQZBGMUNOPQEA-UHFFFAOYSA-N |
| XLogP | 1.27 |
| TPSA | 138.59 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 369.79 |
| LogP ≤ 5 | 1.27 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'catechol', 'substructure': 'N/A'}, {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|