C13H14N4O2 — CID 134359397
4-amino-N-(4,5-diamino-2-hydroxyphenyl)benzamide (PubChem CID 134359397) has the molecular formula C13H14N4O2 and a molecular weight of 258.28 g/mol. Its IUPAC name is 4-amino-N-(4,5-diamino-2-hydroxyphenyl)benzamide.
| Compound Name | 4-amino-N-(4,5-diamino-2-hydroxyphenyl)benzamide |
|---|---|
| PubChem CID | 134359397 |
| Molecular Formula | C13H14N4O2 |
| Molecular Weight | 258.28 g/mol |
| Exact Mass | 258.11 |
| IUPAC Name | 4-amino-N-(4,5-diamino-2-hydroxyphenyl)benzamide |
| SMILES | Nc1ccc(C(=O)Nc2cc(N)c(N)cc2O)cc1 |
| InChI | InChI=1S/C13H14N4O2/c14-8-3-1-7(2-4-8)13(19)17-11-5-9(15)10(16)6-12(11)18/h1-6,18H,14-16H2,(H,17,19) |
| InChIKey | GANIJJFHLKPWQX-UHFFFAOYSA-N |
| XLogP | 1.39 |
| TPSA | 127.39 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 258.28 |
| LogP ≤ 5 | 1.39 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'catechol', 'substructure': 'N/A'}, {'alert_name': 'hydroquinone', 'substructure': 'N/A'} |
|---|