C16H12F6N2O2 — CID 175048386
4-amino-N-[5-(1,1,2,2,3,3-hexafluoropropyl)-2-hydroxyphenyl]benzamide (PubChem CID 175048386) has the molecular formula C16H12F6N2O2 and a molecular weight of 378.27 g/mol. Its IUPAC name is 4-amino-N-[5-(1,1,2,2,3,3-hexafluoropropyl)-2-hydroxyphenyl]benzamide.
| Compound Name | 4-amino-N-[5-(1,1,2,2,3,3-hexafluoropropyl)-2-hydroxyphenyl]benzamide |
|---|---|
| PubChem CID | 175048386 |
| Molecular Formula | C16H12F6N2O2 |
| Molecular Weight | 378.27 g/mol |
| Exact Mass | 378.08 |
| IUPAC Name | 4-amino-N-[5-(1,1,2,2,3,3-hexafluoropropyl)-2-hydroxyphenyl]benzamide |
| SMILES | Nc1ccc(C(=O)Nc2cc(C(F)(F)C(F)(F)C(F)F)ccc2O)cc1 |
| InChI | InChI=1S/C16H12F6N2O2/c17-14(18)16(21,22)15(19,20)9-3-6-12(25)11(7-9)24-13(26)8-1-4-10(23)5-2-8/h1-7,14,25H,23H2,(H,24,26) |
| InChIKey | NAZMEPYMECXFQA-UHFFFAOYSA-N |
| XLogP | 4.22 |
| TPSA | 75.35 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 378.27 |
| LogP ≤ 5 | 4.22 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'catechol', 'substructure': 'N/A'}, {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|