C42H30F12N4O8 — CID 58868378
1-N,3-N-bis[5-[2-(3-acetamido-4-hydroxyphenyl)-1,1,1,3,3,3-hexafluoropropan-2-yl]-2-hydroxyphenyl]benzene-1,3-dicarboxamide (PubChem CID 58868378) has the molecular formula C42H30F12N4O8 and a molecular weight of 946.70 g/mol. Its IUPAC name is 1-N,3-N-bis[5-[2-(3-acetamido-4-hydroxyphenyl)-1,1,1,3,3,3-hexafluoropropan-2-yl]-2-hydroxyphenyl]benzene-1,3-dicarboxamide.
| Compound Name | 1-N,3-N-bis[5-[2-(3-acetamido-4-hydroxyphenyl)-1,1,1,3,3,3-hexafluoropropan-2-yl]-2-hydroxyphenyl]benzene-1,3-dicarboxamide |
|---|---|
| PubChem CID | 58868378 |
| Molecular Formula | C42H30F12N4O8 |
| Molecular Weight | 946.70 g/mol |
| Exact Mass | 946.19 |
| IUPAC Name | 1-N,3-N-bis[5-[2-(3-acetamido-4-hydroxyphenyl)-1,1,1,3,3,3-hexafluoropropan-2-yl]-2-hydroxyphenyl]benzene-1,3-dicarboxamide |
| SMILES | CC(=O)Nc1cc(C(c2ccc(O)c(NC(=O)c3cccc(C(=O)Nc4cc(C(c5ccc(O)c(NC(C)=O)c5)(C(F)(F)F)C(F)(F)F)ccc4O)c3)c2)(C(F)(F)F)C(F)(F)F)ccc1O |
| InChI | InChI=1S/C42H30F12N4O8/c1-19(59)55-27-15-23(6-10-31(27)61)37(39(43,44)45,40(46,47)48)25-8-12-33(63)29(17-25)57-35(65)21-4-3-5-22(14-21)36(66)58-30-18-26(9-13-34(30)64)38(41(49,50)51,42(52,53)54)24-7-11-32(62)28(16-24)56-20(2)60/h3-18,61-64H,1-2H3,(H,55,59)(H,56,60)(H,57,65)(H,58,66) |
| InChIKey | PINITFBPHDIBIU-UHFFFAOYSA-N |
| XLogP | 9.75 |
| TPSA | 197.32 Ų |
| H-Bond Donors | 8 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 66 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 946.70 |
| LogP ≤ 5 | 9.75 |
| H-Bond Donors ≤ 5 | 8 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'catechol', 'substructure': 'N/A'} |
|---|