C31H12F14N2O8 — CID 146853873
2-[[5-[2-[3-[(2-carboxy-3,4,5,6-tetrafluorobenzoyl)amino]-4-hydroxyphenyl]-1,1,1,3,3,3-hexafluoropropan-2-yl]-2-hydroxyphenyl]carbamoyl]-3,4,5,6-tetrafluorobenzoic acid (PubChem CID 146853873) has the molecular formula C31H12F14N2O8 and a molecular weight of 806.41 g/mol. Its IUPAC name is 2-[[5-[2-[3-[(2-carboxy-3,4,5,6-tetrafluorobenzoyl)amino]-4-hydroxyphenyl]-1,1,1,3,3,3-hexafluoropropan-2-yl]-2-hydroxyphenyl]carbamoyl]-3,4,5,6-tetrafluorobenzoic acid.
| Compound Name | 2-[[5-[2-[3-[(2-carboxy-3,4,5,6-tetrafluorobenzoyl)amino]-4-hydroxyphenyl]-1,1,1,3,3,3-hexafluoropropan-2-yl]-2-hydroxyphenyl]carbamoyl]-3,4,5,6-tetrafluorobenzoic acid |
|---|---|
| PubChem CID | 146853873 |
| Molecular Formula | C31H12F14N2O8 |
| Molecular Weight | 806.41 g/mol |
| Exact Mass | 806.04 |
| IUPAC Name | 2-[[5-[2-[3-[(2-carboxy-3,4,5,6-tetrafluorobenzoyl)amino]-4-hydroxyphenyl]-1,1,1,3,3,3-hexafluoropropan-2-yl]-2-hydroxyphenyl]carbamoyl]-3,4,5,6-tetrafluorobenzoic acid |
| SMILES | O=C(O)c1c(F)c(F)c(F)c(F)c1C(=O)Nc1cc(C(c2ccc(O)c(NC(=O)c3c(F)c(F)c(F)c(F)c3C(=O)O)c2)(C(F)(F)F)C(F)(F)F)ccc1O |
| InChI | InChI=1S/C31H12F14N2O8/c32-17-13(15(27(52)53)19(34)23(38)21(17)36)25(50)46-9-5-7(1-3-11(9)48)29(30(40,41)42,31(43,44)45)8-2-4-12(49)10(6-8)47-26(51)14-16(28(54)55)20(35)24(39)22(37)18(14)33/h1-6,48-49H,(H,46,50)(H,47,51)(H,52,53)(H,54,55) |
| InChIKey | SJEXLIYXZKOLGL-UHFFFAOYSA-N |
| XLogP | 7.52 |
| TPSA | 173.26 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 55 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 806.41 |
| LogP ≤ 5 | 7.52 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'catechol', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|