C35H40F6N2O4 — CID 89225691
3-(2-ethyl-2-methylbutanoyl)-N-[5-[1,1,1,3,3,3-hexafluoro-2-[4-hydroxy-3-(3-methylpentan-3-ylamino)phenyl]propan-2-yl]-2-hydroxyphenyl]benzamide (PubChem CID 89225691) has the molecular formula C35H40F6N2O4 and a molecular weight of 666.70 g/mol. Its IUPAC name is 3-(2-ethyl-2-methylbutanoyl)-N-[5-[1,1,1,3,3,3-hexafluoro-2-[4-hydroxy-3-(3-methylpentan-3-ylamino)phenyl]propan-2-yl]-2-hydroxyphenyl]benzamide.
| Compound Name | 3-(2-ethyl-2-methylbutanoyl)-N-[5-[1,1,1,3,3,3-hexafluoro-2-[4-hydroxy-3-(3-methylpentan-3-ylamino)phenyl]propan-2-yl]-2-hydroxyphenyl]benzamide |
|---|---|
| PubChem CID | 89225691 |
| Molecular Formula | C35H40F6N2O4 |
| Molecular Weight | 666.70 g/mol |
| Exact Mass | 666.29 |
| IUPAC Name | 3-(2-ethyl-2-methylbutanoyl)-N-[5-[1,1,1,3,3,3-hexafluoro-2-[4-hydroxy-3-(3-methylpentan-3-ylamino)phenyl]propan-2-yl]-2-hydroxyphenyl]benzamide |
| SMILES | CCC(C)(CC)Nc1cc(C(c2ccc(O)c(NC(=O)c3cccc(C(=O)C(C)(CC)CC)c3)c2)(C(F)(F)F)C(F)(F)F)ccc1O |
| InChI | InChI=1S/C35H40F6N2O4/c1-7-31(5,8-2)29(46)21-12-11-13-22(18-21)30(47)42-25-19-23(14-16-27(25)44)33(34(36,37)38,35(39,40)41)24-15-17-28(45)26(20-24)43-32(6,9-3)10-4/h11-20,43-45H,7-10H2,1-6H3,(H,42,47) |
| InChIKey | CVOQEIGAUMBGOQ-UHFFFAOYSA-N |
| XLogP | 9.76 |
| TPSA | 98.66 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 47 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 666.70 |
| LogP ≤ 5 | 9.76 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'catechol', 'substructure': 'N/A'} |
|---|