C30H25F6N3O4 — CID 145197022
3-amino-N-[5-[1,1,1,3,3,3-hexafluoro-2-[4-hydroxy-3-[(5-methylcyclohexa-2,4-diene-1-carbonyl)amino]phenyl]propan-2-yl]-2-hydroxyphenyl]benzamide (PubChem CID 145197022) has the molecular formula C30H25F6N3O4 and a molecular weight of 605.54 g/mol. Its IUPAC name is 3-amino-N-[5-[1,1,1,3,3,3-hexafluoro-2-[4-hydroxy-3-[(5-methylcyclohexa-2,4-diene-1-carbonyl)amino]phenyl]propan-2-yl]-2-hydroxyphenyl]benzamide.
| Compound Name | 3-amino-N-[5-[1,1,1,3,3,3-hexafluoro-2-[4-hydroxy-3-[(5-methylcyclohexa-2,4-diene-1-carbonyl)amino]phenyl]propan-2-yl]-2-hydroxyphenyl]benzamide |
|---|---|
| PubChem CID | 145197022 |
| Molecular Formula | C30H25F6N3O4 |
| Molecular Weight | 605.54 g/mol |
| Exact Mass | 605.17 |
| IUPAC Name | 3-amino-N-[5-[1,1,1,3,3,3-hexafluoro-2-[4-hydroxy-3-[(5-methylcyclohexa-2,4-diene-1-carbonyl)amino]phenyl]propan-2-yl]-2-hydroxyphenyl]benzamide |
| SMILES | CC1=CC=CC(C(=O)Nc2cc(C(c3ccc(O)c(NC(=O)c4cccc(N)c4)c3)(C(F)(F)F)C(F)(F)F)ccc2O)C1 |
| InChI | InChI=1S/C30H25F6N3O4/c1-16-4-2-5-17(12-16)26(42)38-22-14-19(8-10-24(22)40)28(29(31,32)33,30(34,35)36)20-9-11-25(41)23(15-20)39-27(43)18-6-3-7-21(37)13-18/h2-11,13-15,17,40-41H,12,37H2,1H3,(H,38,42)(H,39,43) |
| InChIKey | NCOOVTKZEZBNEZ-UHFFFAOYSA-N |
| XLogP | 6.80 |
| TPSA | 124.68 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 43 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 605.54 |
| LogP ≤ 5 | 6.80 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'catechol', 'substructure': 'N/A'} |
|---|