C29H18F6N4O8 — CID 5122238
N-[5-[1,1,1,3,3,3-hexafluoro-2-[4-hydroxy-3-[(4-nitrobenzoyl)amino]phenyl]propan-2-yl]-2-hydroxyphenyl]-4-nitrobenzamide (PubChem CID 5122238) has the molecular formula C29H18F6N4O8 and a molecular weight of 664.47 g/mol. Its IUPAC name is N-[5-[1,1,1,3,3,3-hexafluoro-2-[4-hydroxy-3-[(4-nitrobenzoyl)amino]phenyl]propan-2-yl]-2-hydroxyphenyl]-4-nitrobenzamide.
| Compound Name | N-[5-[1,1,1,3,3,3-hexafluoro-2-[4-hydroxy-3-[(4-nitrobenzoyl)amino]phenyl]propan-2-yl]-2-hydroxyphenyl]-4-nitrobenzamide |
|---|---|
| PubChem CID | 5122238 |
| Molecular Formula | C29H18F6N4O8 |
| Molecular Weight | 664.47 g/mol |
| Exact Mass | 664.10 |
| IUPAC Name | N-[5-[1,1,1,3,3,3-hexafluoro-2-[4-hydroxy-3-[(4-nitrobenzoyl)amino]phenyl]propan-2-yl]-2-hydroxyphenyl]-4-nitrobenzamide |
| SMILES | O=C(Nc1cc(C(c2ccc(O)c(NC(=O)c3ccc([N+](=O)[O-])cc3)c2)(C(F)(F)F)C(F)(F)F)ccc1O)c1ccc([N+](=O)[O-])cc1 |
| InChI | InChI=1S/C29H18F6N4O8/c30-28(31,32)27(29(33,34)35,17-5-11-23(40)21(13-17)36-25(42)15-1-7-19(8-2-15)38(44)45)18-6-12-24(41)22(14-18)37-26(43)16-3-9-20(10-4-16)39(46)47/h1-14,40-41H,(H,36,42)(H,37,43) |
| InChIKey | DAECRSIXZCPEEY-UHFFFAOYSA-N |
| XLogP | 6.83 |
| TPSA | 184.94 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 47 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 664.47 |
| LogP ≤ 5 | 6.83 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'catechol', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|