C23H18F6N2O3 — CID 170150968
3-amino-N-[5-[1,1,1,3,3,3-hexafluoro-2-(4-hydroxy-3-methylphenyl)propan-2-yl]-2-hydroxyphenyl]benzamide (PubChem CID 170150968) has the molecular formula C23H18F6N2O3 and a molecular weight of 484.40 g/mol. Its IUPAC name is 3-amino-N-[5-[1,1,1,3,3,3-hexafluoro-2-(4-hydroxy-3-methylphenyl)propan-2-yl]-2-hydroxyphenyl]benzamide.
| Compound Name | 3-amino-N-[5-[1,1,1,3,3,3-hexafluoro-2-(4-hydroxy-3-methylphenyl)propan-2-yl]-2-hydroxyphenyl]benzamide |
|---|---|
| PubChem CID | 170150968 |
| Molecular Formula | C23H18F6N2O3 |
| Molecular Weight | 484.40 g/mol |
| Exact Mass | 484.12 |
| IUPAC Name | 3-amino-N-[5-[1,1,1,3,3,3-hexafluoro-2-(4-hydroxy-3-methylphenyl)propan-2-yl]-2-hydroxyphenyl]benzamide |
| SMILES | Cc1cc(C(c2ccc(O)c(NC(=O)c3cccc(N)c3)c2)(C(F)(F)F)C(F)(F)F)ccc1O |
| InChI | InChI=1S/C23H18F6N2O3/c1-12-9-14(5-7-18(12)32)21(22(24,25)26,23(27,28)29)15-6-8-19(33)17(11-15)31-20(34)13-3-2-4-16(30)10-13/h2-11,32-33H,30H2,1H3,(H,31,34) |
| InChIKey | UYFXGRUNTJXYTK-UHFFFAOYSA-N |
| XLogP | 5.65 |
| TPSA | 95.58 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 484.40 |
| LogP ≤ 5 | 5.65 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'catechol', 'substructure': 'N/A'} |
|---|