C17H15F6NO2 — CID 162553181
4-[1,1,1,3,3,3-hexafluoro-2-[4-hydroxy-3-(methylamino)phenyl]propan-2-yl]-2-methylphenol (PubChem CID 162553181) has the molecular formula C17H15F6NO2 and a molecular weight of 379.30 g/mol. Its IUPAC name is 4-[1,1,1,3,3,3-hexafluoro-2-[4-hydroxy-3-(methylamino)phenyl]propan-2-yl]-2-methylphenol.
| Compound Name | 4-[1,1,1,3,3,3-hexafluoro-2-[4-hydroxy-3-(methylamino)phenyl]propan-2-yl]-2-methylphenol |
|---|---|
| PubChem CID | 162553181 |
| Molecular Formula | C17H15F6NO2 |
| Molecular Weight | 379.30 g/mol |
| Exact Mass | 379.10 |
| IUPAC Name | 4-[1,1,1,3,3,3-hexafluoro-2-[4-hydroxy-3-(methylamino)phenyl]propan-2-yl]-2-methylphenol |
| SMILES | CNc1cc(C(c2ccc(O)c(C)c2)(C(F)(F)F)C(F)(F)F)ccc1O |
| InChI | InChI=1S/C17H15F6NO2/c1-9-7-10(3-5-13(9)25)15(16(18,19)20,17(21,22)23)11-4-6-14(26)12(8-11)24-2/h3-8,24-26H,1-2H3 |
| InChIKey | BFWQUKUAICJEMZ-UHFFFAOYSA-N |
| XLogP | 4.86 |
| TPSA | 52.49 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 379.30 |
| LogP ≤ 5 | 4.86 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'catechol', 'substructure': 'N/A'} |
|---|