C19H12F6N4O2 — CID 168545340
2-[[5-[2-(3-amino-4-hydroxyphenyl)-1,1,1,3,3,3-hexafluoropropan-2-yl]-2-hydroxyanilino]methylidene]propanedinitrile (PubChem CID 168545340) has the molecular formula C19H12F6N4O2 and a molecular weight of 442.32 g/mol. Its IUPAC name is 2-[[5-[2-(3-amino-4-hydroxyphenyl)-1,1,1,3,3,3-hexafluoropropan-2-yl]-2-hydroxyanilino]methylidene]propanedinitrile.
| Compound Name | 2-[[5-[2-(3-amino-4-hydroxyphenyl)-1,1,1,3,3,3-hexafluoropropan-2-yl]-2-hydroxyanilino]methylidene]propanedinitrile |
|---|---|
| PubChem CID | 168545340 |
| Molecular Formula | C19H12F6N4O2 |
| Molecular Weight | 442.32 g/mol |
| Exact Mass | 442.09 |
| IUPAC Name | 2-[[5-[2-(3-amino-4-hydroxyphenyl)-1,1,1,3,3,3-hexafluoropropan-2-yl]-2-hydroxyanilino]methylidene]propanedinitrile |
| SMILES | N#CC(C#N)=CNc1cc(C(c2ccc(O)c(N)c2)(C(F)(F)F)C(F)(F)F)ccc1O |
| InChI | InChI=1S/C19H12F6N4O2/c20-18(21,22)17(19(23,24)25,11-1-3-15(30)13(28)5-11)12-2-4-16(31)14(6-12)29-9-10(7-26)8-27/h1-6,9,29-31H,28H2 |
| InChIKey | IAPSPPGJIQLNPB-UHFFFAOYSA-N |
| XLogP | 4.43 |
| TPSA | 126.09 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 442.32 |
| LogP ≤ 5 | 4.43 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'catechol', 'substructure': 'N/A'}, {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'} |
|---|