C11H6F3N3O — CID 168542994
2-[[3-hydroxy-4-(trifluoromethyl)anilino]methylidene]propanedinitrile (PubChem CID 168542994) has the molecular formula C11H6F3N3O and a molecular weight of 253.18 g/mol. Its IUPAC name is 2-[[3-hydroxy-4-(trifluoromethyl)anilino]methylidene]propanedinitrile.
| Compound Name | 2-[[3-hydroxy-4-(trifluoromethyl)anilino]methylidene]propanedinitrile |
|---|---|
| PubChem CID | 168542994 |
| Molecular Formula | C11H6F3N3O |
| Molecular Weight | 253.18 g/mol |
| Exact Mass | 253.05 |
| IUPAC Name | 2-[[3-hydroxy-4-(trifluoromethyl)anilino]methylidene]propanedinitrile |
| SMILES | N#CC(C#N)=CNc1ccc(C(F)(F)F)c(O)c1 |
| InChI | InChI=1S/C11H6F3N3O/c12-11(13,14)9-2-1-8(3-10(9)18)17-6-7(4-15)5-16/h1-3,6,17-18H |
| InChIKey | VOMUPJRRZBKTFD-UHFFFAOYSA-N |
| XLogP | 2.75 |
| TPSA | 79.84 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 253.18 |
| LogP ≤ 5 | 2.75 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'} |
|---|