C18H10F5N3O2 — CID 168545196
2-[[3-[2,6-difluoro-4-(trifluoromethyl)phenoxy]-4-methoxyanilino]methylidene]propanedinitrile (PubChem CID 168545196) has the molecular formula C18H10F5N3O2 and a molecular weight of 395.29 g/mol. Its IUPAC name is 2-[[3-[2,6-difluoro-4-(trifluoromethyl)phenoxy]-4-methoxyanilino]methylidene]propanedinitrile.
| Compound Name | 2-[[3-[2,6-difluoro-4-(trifluoromethyl)phenoxy]-4-methoxyanilino]methylidene]propanedinitrile |
|---|---|
| PubChem CID | 168545196 |
| Molecular Formula | C18H10F5N3O2 |
| Molecular Weight | 395.29 g/mol |
| Exact Mass | 395.07 |
| IUPAC Name | 2-[[3-[2,6-difluoro-4-(trifluoromethyl)phenoxy]-4-methoxyanilino]methylidene]propanedinitrile |
| SMILES | COc1ccc(NC=C(C#N)C#N)cc1Oc1c(F)cc(C(F)(F)F)cc1F |
| InChI | InChI=1S/C18H10F5N3O2/c1-27-15-3-2-12(26-9-10(7-24)8-25)6-16(15)28-17-13(19)4-11(5-14(17)20)18(21,22)23/h2-6,9,26H,1H3 |
| InChIKey | KPRCNYIWRWBRKT-UHFFFAOYSA-N |
| XLogP | 5.13 |
| TPSA | 78.07 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 395.29 |
| LogP ≤ 5 | 5.13 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'} |
|---|