C17H12F5N5O2 — CID 172979974
(1Z)-2-amino-N-[3-[2,6-difluoro-4-(trifluoromethyl)phenoxy]-4-methoxyanilino]-2-iminoethanimidoyl cyanide (PubChem CID 172979974) has the molecular formula C17H12F5N5O2 and a molecular weight of 413.31 g/mol. Its IUPAC name is (1Z)-2-amino-N-[3-[2,6-difluoro-4-(trifluoromethyl)phenoxy]-4-methoxyanilino]-2-iminoethanimidoyl cyanide.
| Compound Name | (1Z)-2-amino-N-[3-[2,6-difluoro-4-(trifluoromethyl)phenoxy]-4-methoxyanilino]-2-iminoethanimidoyl cyanide |
|---|---|
| PubChem CID | 172979974 |
| Molecular Formula | C17H12F5N5O2 |
| Molecular Weight | 413.31 g/mol |
| Exact Mass | 413.09 |
| IUPAC Name | (1Z)-2-amino-N-[3-[2,6-difluoro-4-(trifluoromethyl)phenoxy]-4-methoxyanilino]-2-iminoethanimidoyl cyanide |
| SMILES | [H]/N=C(N)/C(C#N)=N/Nc1ccc(OC)c(Oc2c(F)cc(C(F)(F)F)cc2F)c1 |
| InChI | InChI=1S/C17H12F5N5O2/c1-28-13-3-2-9(26-27-12(7-23)16(24)25)6-14(13)29-15-10(18)4-8(5-11(15)19)17(20,21)22/h2-6,26H,1H3,(H3,24,25)/b27-12+ |
| InChIKey | XZYRGUMNFRDEQY-KKMKTNMSSA-N |
| XLogP | 4.01 |
| TPSA | 116.51 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 413.31 |
| LogP ≤ 5 | 4.01 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'cyano_imine_A(37)', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|