C16H10F5N5O — CID 172979874
(1Z)-2-amino-N-[4-[2,6-difluoro-4-(trifluoromethyl)phenoxy]anilino]-2-iminoethanimidoyl cyanide (PubChem CID 172979874) has the molecular formula C16H10F5N5O and a molecular weight of 383.28 g/mol. Its IUPAC name is (1Z)-2-amino-N-[4-[2,6-difluoro-4-(trifluoromethyl)phenoxy]anilino]-2-iminoethanimidoyl cyanide.
| Compound Name | (1Z)-2-amino-N-[4-[2,6-difluoro-4-(trifluoromethyl)phenoxy]anilino]-2-iminoethanimidoyl cyanide |
|---|---|
| PubChem CID | 172979874 |
| Molecular Formula | C16H10F5N5O |
| Molecular Weight | 383.28 g/mol |
| Exact Mass | 383.08 |
| IUPAC Name | (1Z)-2-amino-N-[4-[2,6-difluoro-4-(trifluoromethyl)phenoxy]anilino]-2-iminoethanimidoyl cyanide |
| SMILES | [H]/N=C(N)/C(C#N)=N/Nc1ccc(Oc2c(F)cc(C(F)(F)F)cc2F)cc1 |
| InChI | InChI=1S/C16H10F5N5O/c17-11-5-8(16(19,20)21)6-12(18)14(11)27-10-3-1-9(2-4-10)25-26-13(7-22)15(23)24/h1-6,25H,(H3,23,24)/b26-13+ |
| InChIKey | VUHXWINXUJZKNE-LGJNPRDNSA-N |
| XLogP | 4.00 |
| TPSA | 107.28 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 383.28 |
| LogP ≤ 5 | 4.00 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'cyano_imine_A(37)', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|