C9H7F2N5 — CID 172980258
(1Z)-2-amino-N-(3,5-difluoroanilino)-2-iminoethanimidoyl cyanide (PubChem CID 172980258) has the molecular formula C9H7F2N5 and a molecular weight of 223.19 g/mol. Its IUPAC name is (1Z)-2-amino-N-(3,5-difluoroanilino)-2-iminoethanimidoyl cyanide.
| Compound Name | (1Z)-2-amino-N-(3,5-difluoroanilino)-2-iminoethanimidoyl cyanide |
|---|---|
| PubChem CID | 172980258 |
| Molecular Formula | C9H7F2N5 |
| Molecular Weight | 223.19 g/mol |
| Exact Mass | 223.07 |
| IUPAC Name | (1Z)-2-amino-N-(3,5-difluoroanilino)-2-iminoethanimidoyl cyanide |
| SMILES | [H]/N=C(N)/C(C#N)=N/Nc1cc(F)cc(F)c1 |
| InChI | InChI=1S/C9H7F2N5/c10-5-1-6(11)3-7(2-5)15-16-8(4-12)9(13)14/h1-3,15H,(H3,13,14)/b16-8+ |
| InChIKey | FMUMHMFWQJXXRB-LZYBPNLTSA-N |
| XLogP | 1.19 |
| TPSA | 98.05 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 223.19 |
| LogP ≤ 5 | 1.19 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'cyano_imine_A(37)', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|