C10H6F4IN5 — CID 172978285
(1Z)-2-amino-N-[5-fluoro-2-iodo-3-(trifluoromethyl)anilino]-2-iminoethanimidoyl cyanide (PubChem CID 172978285) has the molecular formula C10H6F4IN5 and a molecular weight of 399.09 g/mol. Its IUPAC name is (1Z)-2-amino-N-[5-fluoro-2-iodo-3-(trifluoromethyl)anilino]-2-iminoethanimidoyl cyanide.
| Compound Name | (1Z)-2-amino-N-[5-fluoro-2-iodo-3-(trifluoromethyl)anilino]-2-iminoethanimidoyl cyanide |
|---|---|
| PubChem CID | 172978285 |
| Molecular Formula | C10H6F4IN5 |
| Molecular Weight | 399.09 g/mol |
| Exact Mass | 398.96 |
| IUPAC Name | (1Z)-2-amino-N-[5-fluoro-2-iodo-3-(trifluoromethyl)anilino]-2-iminoethanimidoyl cyanide |
| SMILES | [H]/N=C(N)/C(C#N)=N/Nc1cc(F)cc(C(F)(F)F)c1I |
| InChI | InChI=1S/C10H6F4IN5/c11-4-1-5(10(12,13)14)8(15)6(2-4)19-20-7(3-16)9(17)18/h1-2,19H,(H3,17,18)/b20-7+ |
| InChIKey | CNHHETNSTLOTEM-IFRROFPPSA-N |
| XLogP | 2.68 |
| TPSA | 98.05 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 399.09 |
| LogP ≤ 5 | 2.68 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'cyano_imine_A(37)', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|