C9H6BrClFN5 — CID 172979744
(1Z)-2-amino-N-(3-bromo-2-chloro-5-fluoroanilino)-2-iminoethanimidoyl cyanide (PubChem CID 172979744) has the molecular formula C9H6BrClFN5 and a molecular weight of 318.54 g/mol. Its IUPAC name is (1Z)-2-amino-N-(3-bromo-2-chloro-5-fluoroanilino)-2-iminoethanimidoyl cyanide.
| Compound Name | (1Z)-2-amino-N-(3-bromo-2-chloro-5-fluoroanilino)-2-iminoethanimidoyl cyanide |
|---|---|
| PubChem CID | 172979744 |
| Molecular Formula | C9H6BrClFN5 |
| Molecular Weight | 318.54 g/mol |
| Exact Mass | 316.95 |
| IUPAC Name | (1Z)-2-amino-N-(3-bromo-2-chloro-5-fluoroanilino)-2-iminoethanimidoyl cyanide |
| SMILES | [H]/N=C(N)/C(C#N)=N/Nc1cc(F)cc(Br)c1Cl |
| InChI | InChI=1S/C9H6BrClFN5/c10-5-1-4(12)2-6(8(5)11)16-17-7(3-13)9(14)15/h1-2,16H,(H3,14,15)/b17-7+ |
| InChIKey | OKKARXQPPLYARN-REZTVBANSA-N |
| XLogP | 2.47 |
| TPSA | 98.05 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 318.54 |
| LogP ≤ 5 | 2.47 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'cyano_imine_A(37)', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|