C9H6ClF2N5 — CID 172931806
(1Z)-2-amino-N-(5-chloro-2,4-difluoroanilino)-2-iminoethanimidoyl cyanide (PubChem CID 172931806) has the molecular formula C9H6ClF2N5 and a molecular weight of 257.63 g/mol. Its IUPAC name is (1Z)-2-amino-N-(5-chloro-2,4-difluoroanilino)-2-iminoethanimidoyl cyanide.
| Compound Name | (1Z)-2-amino-N-(5-chloro-2,4-difluoroanilino)-2-iminoethanimidoyl cyanide |
|---|---|
| PubChem CID | 172931806 |
| Molecular Formula | C9H6ClF2N5 |
| Molecular Weight | 257.63 g/mol |
| Exact Mass | 257.03 |
| IUPAC Name | (1Z)-2-amino-N-(5-chloro-2,4-difluoroanilino)-2-iminoethanimidoyl cyanide |
| SMILES | [H]/N=C(N)/C(C#N)=N/Nc1cc(Cl)c(F)cc1F |
| InChI | InChI=1S/C9H6ClF2N5/c10-4-1-7(6(12)2-5(4)11)16-17-8(3-13)9(14)15/h1-2,16H,(H3,14,15)/b17-8+ |
| InChIKey | DOSKIJXUAMFTSW-CAOOACKPSA-N |
| XLogP | 1.85 |
| TPSA | 98.05 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 257.63 |
| LogP ≤ 5 | 1.85 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'cyano_imine_A(37)', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|