C9H8FN5 — CID 172976781
(1Z)-2-amino-N-(2-fluoroanilino)-2-iminoethanimidoyl cyanide (PubChem CID 172976781) has the molecular formula C9H8FN5 and a molecular weight of 205.20 g/mol. Its IUPAC name is (1Z)-2-amino-N-(2-fluoroanilino)-2-iminoethanimidoyl cyanide.
| Compound Name | (1Z)-2-amino-N-(2-fluoroanilino)-2-iminoethanimidoyl cyanide |
|---|---|
| PubChem CID | 172976781 |
| Molecular Formula | C9H8FN5 |
| Molecular Weight | 205.20 g/mol |
| Exact Mass | 205.08 |
| IUPAC Name | (1Z)-2-amino-N-(2-fluoroanilino)-2-iminoethanimidoyl cyanide |
| SMILES | [H]/N=C(N)/C(C#N)=N/Nc1ccccc1F |
| InChI | InChI=1S/C9H8FN5/c10-6-3-1-2-4-7(6)14-15-8(5-11)9(12)13/h1-4,14H,(H3,12,13)/b15-8+ |
| InChIKey | BUIYZJZBSUYLDD-OVCLIPMQSA-N |
| XLogP | 1.05 |
| TPSA | 98.05 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 205.20 |
| LogP ≤ 5 | 1.05 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'cyano_imine_A(37)', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|