C9H5Br2Cl2N5 — CID 172932026
(1Z)-2-amino-N-(2,4-dibromo-3,6-dichloroanilino)-2-iminoethanimidoyl cyanide (PubChem CID 172932026) has the molecular formula C9H5Br2Cl2N5 and a molecular weight of 413.89 g/mol. Its IUPAC name is (1Z)-2-amino-N-(2,4-dibromo-3,6-dichloroanilino)-2-iminoethanimidoyl cyanide.
| Compound Name | (1Z)-2-amino-N-(2,4-dibromo-3,6-dichloroanilino)-2-iminoethanimidoyl cyanide |
|---|---|
| PubChem CID | 172932026 |
| Molecular Formula | C9H5Br2Cl2N5 |
| Molecular Weight | 413.89 g/mol |
| Exact Mass | 410.83 |
| IUPAC Name | (1Z)-2-amino-N-(2,4-dibromo-3,6-dichloroanilino)-2-iminoethanimidoyl cyanide |
| SMILES | [H]/N=C(N)/C(C#N)=N/Nc1c(Cl)cc(Br)c(Cl)c1Br |
| InChI | InChI=1S/C9H5Br2Cl2N5/c10-3-1-4(12)8(6(11)7(3)13)18-17-5(2-14)9(15)16/h1,18H,(H3,15,16)/b17-5+ |
| InChIKey | HKVTYRZPQPAKEO-YAXRCOADSA-N |
| XLogP | 3.75 |
| TPSA | 98.05 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 413.89 |
| LogP ≤ 5 | 3.75 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'cyano_imine_A(37)', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|