C12H6Cl2F7N5 — CID 172932081
(1Z)-2-amino-N-[2,6-dichloro-4-(1,1,1,2,3,3,3-heptafluoropropan-2-yl)anilino]-2-iminoethanimidoyl cyanide (PubChem CID 172932081) has the molecular formula C12H6Cl2F7N5 and a molecular weight of 424.11 g/mol. Its IUPAC name is (1Z)-2-amino-N-[2,6-dichloro-4-(1,1,1,2,3,3,3-heptafluoropropan-2-yl)anilino]-2-iminoethanimidoyl cyanide.
| Compound Name | (1Z)-2-amino-N-[2,6-dichloro-4-(1,1,1,2,3,3,3-heptafluoropropan-2-yl)anilino]-2-iminoethanimidoyl cyanide |
|---|---|
| PubChem CID | 172932081 |
| Molecular Formula | C12H6Cl2F7N5 |
| Molecular Weight | 424.11 g/mol |
| Exact Mass | 422.99 |
| IUPAC Name | (1Z)-2-amino-N-[2,6-dichloro-4-(1,1,1,2,3,3,3-heptafluoropropan-2-yl)anilino]-2-iminoethanimidoyl cyanide |
| SMILES | [H]/N=C(N)/C(C#N)=N/Nc1c(Cl)cc(C(F)(C(F)(F)F)C(F)(F)F)cc1Cl |
| InChI | InChI=1S/C12H6Cl2F7N5/c13-5-1-4(10(15,11(16,17)18)12(19,20)21)2-6(14)8(5)26-25-7(3-22)9(23)24/h1-2,26H,(H3,23,24)/b25-7+ |
| InChIKey | OXCLSQPMOPUXPO-JRXWSOMVSA-N |
| XLogP | 4.51 |
| TPSA | 98.05 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 424.11 |
| LogP ≤ 5 | 4.51 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'cyano_imine_A(37)', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|