C10H5BrClFN6 — CID 172977454
(1Z)-2-amino-N-(6-bromo-4-chloro-2-cyano-3-fluoroanilino)-2-iminoethanimidoyl cyanide (PubChem CID 172977454) has the molecular formula C10H5BrClFN6 and a molecular weight of 343.55 g/mol. Its IUPAC name is (1Z)-2-amino-N-(6-bromo-4-chloro-2-cyano-3-fluoroanilino)-2-iminoethanimidoyl cyanide.
| Compound Name | (1Z)-2-amino-N-(6-bromo-4-chloro-2-cyano-3-fluoroanilino)-2-iminoethanimidoyl cyanide |
|---|---|
| PubChem CID | 172977454 |
| Molecular Formula | C10H5BrClFN6 |
| Molecular Weight | 343.55 g/mol |
| Exact Mass | 341.94 |
| IUPAC Name | (1Z)-2-amino-N-(6-bromo-4-chloro-2-cyano-3-fluoroanilino)-2-iminoethanimidoyl cyanide |
| SMILES | [H]/N=C(N)/C(C#N)=N/Nc1c(Br)cc(Cl)c(F)c1C#N |
| InChI | InChI=1S/C10H5BrClFN6/c11-5-1-6(12)8(13)4(2-14)9(5)19-18-7(3-15)10(16)17/h1,19H,(H3,16,17)/b18-7+ |
| InChIKey | UCZMDWTVNSPMRL-CNHKJKLMSA-N |
| XLogP | 2.34 |
| TPSA | 121.84 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 343.55 |
| LogP ≤ 5 | 2.34 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'cyano_imine_A(37)', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|