C10H6Br2F3N5 — CID 172931638
(1Z)-2-amino-N-[2,4-dibromo-6-(trifluoromethyl)anilino]-2-iminoethanimidoyl cyanide (PubChem CID 172931638) has the molecular formula C10H6Br2F3N5 and a molecular weight of 413.00 g/mol. Its IUPAC name is (1Z)-2-amino-N-[2,4-dibromo-6-(trifluoromethyl)anilino]-2-iminoethanimidoyl cyanide.
| Compound Name | (1Z)-2-amino-N-[2,4-dibromo-6-(trifluoromethyl)anilino]-2-iminoethanimidoyl cyanide |
|---|---|
| PubChem CID | 172931638 |
| Molecular Formula | C10H6Br2F3N5 |
| Molecular Weight | 413.00 g/mol |
| Exact Mass | 410.89 |
| IUPAC Name | (1Z)-2-amino-N-[2,4-dibromo-6-(trifluoromethyl)anilino]-2-iminoethanimidoyl cyanide |
| SMILES | [H]/N=C(N)/C(C#N)=N/Nc1c(Br)cc(Br)cc1C(F)(F)F |
| InChI | InChI=1S/C10H6Br2F3N5/c11-4-1-5(10(13,14)15)8(6(12)2-4)20-19-7(3-16)9(17)18/h1-2,20H,(H3,17,18)/b19-7+ |
| InChIKey | XIBPGXPWEVRMFH-FBCYGCLPSA-N |
| XLogP | 3.46 |
| TPSA | 98.05 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 413.00 |
| LogP ≤ 5 | 3.46 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'cyano_imine_A(37)', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|