C10H8BrN5O2 — CID 172931896
3-[(2Z)-2-(2-amino-1-cyano-2-iminoethylidene)hydrazinyl]-5-bromobenzoic acid (PubChem CID 172931896) has the molecular formula C10H8BrN5O2 and a molecular weight of 310.11 g/mol. Its IUPAC name is 3-[(2Z)-2-(2-amino-1-cyano-2-iminoethylidene)hydrazinyl]-5-bromobenzoic acid.
| Compound Name | 3-[(2Z)-2-(2-amino-1-cyano-2-iminoethylidene)hydrazinyl]-5-bromobenzoic acid |
|---|---|
| PubChem CID | 172931896 |
| Molecular Formula | C10H8BrN5O2 |
| Molecular Weight | 310.11 g/mol |
| Exact Mass | 308.99 |
| IUPAC Name | 3-[(2Z)-2-(2-amino-1-cyano-2-iminoethylidene)hydrazinyl]-5-bromobenzoic acid |
| SMILES | [H]/N=C(N)/C(C#N)=N/Nc1cc(Br)cc(C(=O)O)c1 |
| InChI | InChI=1S/C10H8BrN5O2/c11-6-1-5(10(17)18)2-7(3-6)15-16-8(4-12)9(13)14/h1-3,15H,(H3,13,14)(H,17,18)/b16-8+ |
| InChIKey | WIRSMLKYDMTVHN-LZYBPNLTSA-N |
| XLogP | 1.37 |
| TPSA | 135.35 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 310.11 |
| LogP ≤ 5 | 1.37 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'cyano_imine_A(37)', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|