C11H13N5O4S2 — CID 172978388
(1Z)-2-amino-N-[3,5-bis(methylsulfonyl)anilino]-2-iminoethanimidoyl cyanide (PubChem CID 172978388) has the molecular formula C11H13N5O4S2 and a molecular weight of 343.39 g/mol. Its IUPAC name is (1Z)-2-amino-N-[3,5-bis(methylsulfonyl)anilino]-2-iminoethanimidoyl cyanide.
| Compound Name | (1Z)-2-amino-N-[3,5-bis(methylsulfonyl)anilino]-2-iminoethanimidoyl cyanide |
|---|---|
| PubChem CID | 172978388 |
| Molecular Formula | C11H13N5O4S2 |
| Molecular Weight | 343.39 g/mol |
| Exact Mass | 343.04 |
| IUPAC Name | (1Z)-2-amino-N-[3,5-bis(methylsulfonyl)anilino]-2-iminoethanimidoyl cyanide |
| SMILES | [H]/N=C(N)/C(C#N)=N/Nc1cc(S(C)(=O)=O)cc(S(C)(=O)=O)c1 |
| InChI | InChI=1S/C11H13N5O4S2/c1-21(17,18)8-3-7(4-9(5-8)22(2,19)20)15-16-10(6-12)11(13)14/h3-5,15H,1-2H3,(H3,13,14)/b16-10+ |
| InChIKey | FQJYNIHUDKPDBO-MHWRWJLKSA-N |
| XLogP | -0.28 |
| TPSA | 166.33 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 343.39 |
| LogP ≤ 5 | -0.28 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'cyano_imine_A(37)', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|