C16H14ClN5O3S — CID 172978245
(1Z)-2-amino-N-[3-(4-chlorophenyl)sulfonyl-5-methoxyanilino]-2-iminoethanimidoyl cyanide (PubChem CID 172978245) has the molecular formula C16H14ClN5O3S and a molecular weight of 391.84 g/mol. Its IUPAC name is (1Z)-2-amino-N-[3-(4-chlorophenyl)sulfonyl-5-methoxyanilino]-2-iminoethanimidoyl cyanide.
| Compound Name | (1Z)-2-amino-N-[3-(4-chlorophenyl)sulfonyl-5-methoxyanilino]-2-iminoethanimidoyl cyanide |
|---|---|
| PubChem CID | 172978245 |
| Molecular Formula | C16H14ClN5O3S |
| Molecular Weight | 391.84 g/mol |
| Exact Mass | 391.05 |
| IUPAC Name | (1Z)-2-amino-N-[3-(4-chlorophenyl)sulfonyl-5-methoxyanilino]-2-iminoethanimidoyl cyanide |
| SMILES | [H]/N=C(N)/C(C#N)=N/Nc1cc(OC)cc(S(=O)(=O)c2ccc(Cl)cc2)c1 |
| InChI | InChI=1S/C16H14ClN5O3S/c1-25-12-6-11(21-22-15(9-18)16(19)20)7-14(8-12)26(23,24)13-4-2-10(17)3-5-13/h2-8,21H,1H3,(H3,19,20)/b22-15+ |
| InChIKey | NMCFPHCGIPWCRQ-PXLXIMEGSA-N |
| XLogP | 2.41 |
| TPSA | 141.42 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 391.84 |
| LogP ≤ 5 | 2.41 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'cyano_imine_A(37)', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|