C17H18N6O4S — CID 172977921
(1Z)-2-amino-N-[4-[(2,5-dimethoxyphenyl)sulfamoyl]anilino]-2-iminoethanimidoyl cyanide (PubChem CID 172977921) has the molecular formula C17H18N6O4S and a molecular weight of 402.44 g/mol. Its IUPAC name is (1Z)-2-amino-N-[4-[(2,5-dimethoxyphenyl)sulfamoyl]anilino]-2-iminoethanimidoyl cyanide.
| Compound Name | (1Z)-2-amino-N-[4-[(2,5-dimethoxyphenyl)sulfamoyl]anilino]-2-iminoethanimidoyl cyanide |
|---|---|
| PubChem CID | 172977921 |
| Molecular Formula | C17H18N6O4S |
| Molecular Weight | 402.44 g/mol |
| Exact Mass | 402.11 |
| IUPAC Name | (1Z)-2-amino-N-[4-[(2,5-dimethoxyphenyl)sulfamoyl]anilino]-2-iminoethanimidoyl cyanide |
| SMILES | [H]/N=C(N)/C(C#N)=N/Nc1ccc(S(=O)(=O)Nc2cc(OC)ccc2OC)cc1 |
| InChI | InChI=1S/C17H18N6O4S/c1-26-12-5-8-16(27-2)14(9-12)23-28(24,25)13-6-3-11(4-7-13)21-22-15(10-18)17(19)20/h3-9,21,23H,1-2H3,(H3,19,20)/b22-15+ |
| InChIKey | CWYVRCZYWSMACV-PXLXIMEGSA-N |
| XLogP | 1.73 |
| TPSA | 162.68 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 402.44 |
| LogP ≤ 5 | 1.73 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'cyano_imine_A(37)', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|