C14H20N6O3S — CID 172977308
(1Z)-2-amino-N-[4-(3-ethoxypropylsulfamoyl)anilino]-2-iminoethanimidoyl cyanide (PubChem CID 172977308) has the molecular formula C14H20N6O3S and a molecular weight of 352.42 g/mol. Its IUPAC name is (1Z)-2-amino-N-[4-(3-ethoxypropylsulfamoyl)anilino]-2-iminoethanimidoyl cyanide.
| Compound Name | (1Z)-2-amino-N-[4-(3-ethoxypropylsulfamoyl)anilino]-2-iminoethanimidoyl cyanide |
|---|---|
| PubChem CID | 172977308 |
| Molecular Formula | C14H20N6O3S |
| Molecular Weight | 352.42 g/mol |
| Exact Mass | 352.13 |
| IUPAC Name | (1Z)-2-amino-N-[4-(3-ethoxypropylsulfamoyl)anilino]-2-iminoethanimidoyl cyanide |
| SMILES | [H]/N=C(N)/C(C#N)=N/Nc1ccc(S(=O)(=O)NCCCOCC)cc1 |
| InChI | InChI=1S/C14H20N6O3S/c1-2-23-9-3-8-18-24(21,22)12-6-4-11(5-7-12)19-20-13(10-15)14(16)17/h4-7,18-19H,2-3,8-9H2,1H3,(H3,16,17)/b20-13+ |
| InChIKey | FPHKBCHIODUQCC-DEDYPNTBSA-N |
| XLogP | 0.62 |
| TPSA | 153.45 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 352.42 |
| LogP ≤ 5 | 0.62 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'cyano_imine_A(37)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|