C13H20ClN3O3S — CID 169366688
2-chloro-N'-[4-(3-ethoxypropylsulfamoyl)phenyl]ethanimidamide (PubChem CID 169366688) has the molecular formula C13H20ClN3O3S and a molecular weight of 333.84 g/mol. Its IUPAC name is 2-chloro-N'-[4-(3-ethoxypropylsulfamoyl)phenyl]ethanimidamide.
| Compound Name | 2-chloro-N'-[4-(3-ethoxypropylsulfamoyl)phenyl]ethanimidamide |
|---|---|
| PubChem CID | 169366688 |
| Molecular Formula | C13H20ClN3O3S |
| Molecular Weight | 333.84 g/mol |
| Exact Mass | 333.09 |
| IUPAC Name | 2-chloro-N'-[4-(3-ethoxypropylsulfamoyl)phenyl]ethanimidamide |
| SMILES | CCOCCCNS(=O)(=O)c1ccc(/N=C(/N)CCl)cc1 |
| InChI | InChI=1S/C13H20ClN3O3S/c1-2-20-9-3-8-16-21(18,19)12-6-4-11(5-7-12)17-13(15)10-14/h4-7,16H,2-3,8-10H2,1H3,(H2,15,17) |
| InChIKey | CSIMWNOOFVXNKX-UHFFFAOYSA-N |
| XLogP | 1.62 |
| TPSA | 93.78 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 333.84 |
| LogP ≤ 5 | 1.62 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|