C16H26ClN3O2S — CID 169368099
2-chloro-N'-[4-(dibutylsulfamoyl)phenyl]ethanimidamide (PubChem CID 169368099) has the molecular formula C16H26ClN3O2S and a molecular weight of 359.92 g/mol. Its IUPAC name is 2-chloro-N'-[4-(dibutylsulfamoyl)phenyl]ethanimidamide.
| Compound Name | 2-chloro-N'-[4-(dibutylsulfamoyl)phenyl]ethanimidamide |
|---|---|
| PubChem CID | 169368099 |
| Molecular Formula | C16H26ClN3O2S |
| Molecular Weight | 359.92 g/mol |
| Exact Mass | 359.14 |
| IUPAC Name | 2-chloro-N'-[4-(dibutylsulfamoyl)phenyl]ethanimidamide |
| SMILES | CCCCN(CCCC)S(=O)(=O)c1ccc(/N=C(/N)CCl)cc1 |
| InChI | InChI=1S/C16H26ClN3O2S/c1-3-5-11-20(12-6-4-2)23(21,22)15-9-7-14(8-10-15)19-16(18)13-17/h7-10H,3-6,11-13H2,1-2H3,(H2,18,19) |
| InChIKey | UNZZELUXRPHQCY-UHFFFAOYSA-N |
| XLogP | 3.51 |
| TPSA | 75.76 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 359.92 |
| LogP ≤ 5 | 3.51 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|