C17H27ClN2O3S — CID 94830973
3-chloro-N-[4-(dibutylsulfamoyl)phenyl]propanamide (PubChem CID 94830973) has the molecular formula C17H27ClN2O3S and a molecular weight of 374.93 g/mol. Its IUPAC name is 3-chloro-N-[4-(dibutylsulfamoyl)phenyl]propanamide.
| Compound Name | 3-chloro-N-[4-(dibutylsulfamoyl)phenyl]propanamide |
|---|---|
| PubChem CID | 94830973 |
| Molecular Formula | C17H27ClN2O3S |
| Molecular Weight | 374.93 g/mol |
| Exact Mass | 374.14 |
| IUPAC Name | 3-chloro-N-[4-(dibutylsulfamoyl)phenyl]propanamide |
| SMILES | CCCCN(CCCC)S(=O)(=O)c1ccc(NC(=O)CCCl)cc1 |
| InChI | InChI=1S/C17H27ClN2O3S/c1-3-5-13-20(14-6-4-2)24(22,23)16-9-7-15(8-10-16)19-17(21)11-12-18/h7-10H,3-6,11-14H2,1-2H3,(H,19,21) |
| InChIKey | IYPUJEJYXFZRDN-UHFFFAOYSA-N |
| XLogP | 3.84 |
| TPSA | 66.48 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 374.93 |
| LogP ≤ 5 | 3.84 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|