C19H31N3O3S2 — CID 4954088
N-[[4-(dipropylsulfamoyl)phenyl]carbamothioyl]hexanamide (PubChem CID 4954088) has the molecular formula C19H31N3O3S2 and a molecular weight of 413.61 g/mol. Its IUPAC name is N-[[4-(dipropylsulfamoyl)phenyl]carbamothioyl]hexanamide.
| Compound Name | N-[[4-(dipropylsulfamoyl)phenyl]carbamothioyl]hexanamide |
|---|---|
| PubChem CID | 4954088 |
| Molecular Formula | C19H31N3O3S2 |
| Molecular Weight | 413.61 g/mol |
| Exact Mass | 413.18 |
| IUPAC Name | N-[[4-(dipropylsulfamoyl)phenyl]carbamothioyl]hexanamide |
| SMILES | CCCCCC(=O)NC(=S)Nc1ccc(S(=O)(=O)N(CCC)CCC)cc1 |
| InChI | InChI=1S/C19H31N3O3S2/c1-4-7-8-9-18(23)21-19(26)20-16-10-12-17(13-11-16)27(24,25)22(14-5-2)15-6-3/h10-13H,4-9,14-15H2,1-3H3,(H2,20,21,23,26) |
| InChIKey | TYVAJKQQVWKVKI-UHFFFAOYSA-N |
| XLogP | 3.89 |
| TPSA | 78.51 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 413.61 |
| LogP ≤ 5 | 3.89 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|