C16H23N3O4S2 — CID 54789393
N-[[4-(acetylsulfamoyl)phenyl]carbamothioyl]heptanamide (PubChem CID 54789393) has the molecular formula C16H23N3O4S2 and a molecular weight of 385.51 g/mol. Its IUPAC name is N-[[4-(acetylsulfamoyl)phenyl]carbamothioyl]heptanamide.
| Compound Name | N-[[4-(acetylsulfamoyl)phenyl]carbamothioyl]heptanamide |
|---|---|
| PubChem CID | 54789393 |
| Molecular Formula | C16H23N3O4S2 |
| Molecular Weight | 385.51 g/mol |
| Exact Mass | 385.11 |
| IUPAC Name | N-[[4-(acetylsulfamoyl)phenyl]carbamothioyl]heptanamide |
| SMILES | CCCCCCC(=O)NC(=S)Nc1ccc(S(=O)(=O)NC(C)=O)cc1 |
| InChI | InChI=1S/C16H23N3O4S2/c1-3-4-5-6-7-15(21)18-16(24)17-13-8-10-14(11-9-13)25(22,23)19-12(2)20/h8-11H,3-7H2,1-2H3,(H,19,20)(H2,17,18,21,24) |
| InChIKey | SSISWZJRGLUEBG-UHFFFAOYSA-N |
| XLogP | 2.29 |
| TPSA | 104.37 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 385.51 |
| LogP ≤ 5 | 2.29 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|