C22H26N4O8S2 — CID 3474503
N,N'-bis[4-(acetylsulfamoyl)phenyl]hexanediamide (PubChem CID 3474503) has the molecular formula C22H26N4O8S2 and a molecular weight of 538.60 g/mol. Its IUPAC name is N,N'-bis[4-(acetylsulfamoyl)phenyl]hexanediamide.
| Compound Name | N,N'-bis[4-(acetylsulfamoyl)phenyl]hexanediamide |
|---|---|
| PubChem CID | 3474503 |
| Molecular Formula | C22H26N4O8S2 |
| Molecular Weight | 538.60 g/mol |
| Exact Mass | 538.12 |
| IUPAC Name | N,N'-bis[4-(acetylsulfamoyl)phenyl]hexanediamide |
| SMILES | CC(=O)NS(=O)(=O)c1ccc(NC(=O)CCCCC(=O)Nc2ccc(S(=O)(=O)NC(C)=O)cc2)cc1 |
| InChI | InChI=1S/C22H26N4O8S2/c1-15(27)25-35(31,32)19-11-7-17(8-12-19)23-21(29)5-3-4-6-22(30)24-18-9-13-20(14-10-18)36(33,34)26-16(2)28/h7-14H,3-6H2,1-2H3,(H,23,29)(H,24,30)(H,25,27)(H,26,28) |
| InChIKey | COIMFWJDNKBBLJ-UHFFFAOYSA-N |
| XLogP | 1.47 |
| TPSA | 184.68 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 538.60 |
| LogP ≤ 5 | 1.47 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|