C27H40N4O6S2 — CID 4924725
N,N'-bis[4-(propan-2-ylsulfamoyl)phenyl]nonanediamide (PubChem CID 4924725) has the molecular formula C27H40N4O6S2 and a molecular weight of 580.77 g/mol. Its IUPAC name is N,N'-bis[4-(propan-2-ylsulfamoyl)phenyl]nonanediamide.
| Compound Name | N,N'-bis[4-(propan-2-ylsulfamoyl)phenyl]nonanediamide |
|---|---|
| PubChem CID | 4924725 |
| Molecular Formula | C27H40N4O6S2 |
| Molecular Weight | 580.77 g/mol |
| Exact Mass | 580.24 |
| IUPAC Name | N,N'-bis[4-(propan-2-ylsulfamoyl)phenyl]nonanediamide |
| SMILES | CC(C)NS(=O)(=O)c1ccc(NC(=O)CCCCCCCC(=O)Nc2ccc(S(=O)(=O)NC(C)C)cc2)cc1 |
| InChI | InChI=1S/C27H40N4O6S2/c1-20(2)30-38(34,35)24-16-12-22(13-17-24)28-26(32)10-8-6-5-7-9-11-27(33)29-23-14-18-25(19-15-23)39(36,37)31-21(3)4/h12-21,30-31H,5-11H2,1-4H3,(H,28,32)(H,29,33) |
| InChIKey | WLHUGBMRVSLVJU-UHFFFAOYSA-N |
| XLogP | 4.37 |
| TPSA | 150.54 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 39 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 580.77 |
| LogP ≤ 5 | 4.37 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|