C21H24N4O8S2 — CID 4199591
N,N'-bis[4-(acetylsulfamoyl)phenyl]pentanediamide (PubChem CID 4199591) has the molecular formula C21H24N4O8S2 and a molecular weight of 524.58 g/mol. Its IUPAC name is N,N'-bis[4-(acetylsulfamoyl)phenyl]pentanediamide.
| Compound Name | N,N'-bis[4-(acetylsulfamoyl)phenyl]pentanediamide |
|---|---|
| PubChem CID | 4199591 |
| Molecular Formula | C21H24N4O8S2 |
| Molecular Weight | 524.58 g/mol |
| Exact Mass | 524.10 |
| IUPAC Name | N,N'-bis[4-(acetylsulfamoyl)phenyl]pentanediamide |
| SMILES | CC(=O)NS(=O)(=O)c1ccc(NC(=O)CCCC(=O)Nc2ccc(S(=O)(=O)NC(C)=O)cc2)cc1 |
| InChI | InChI=1S/C21H24N4O8S2/c1-14(26)24-34(30,31)18-10-6-16(7-11-18)22-20(28)4-3-5-21(29)23-17-8-12-19(13-9-17)35(32,33)25-15(2)27/h6-13H,3-5H2,1-2H3,(H,22,28)(H,23,29)(H,24,26)(H,25,27) |
| InChIKey | OCAWDXIWGFXMIA-UHFFFAOYSA-N |
| XLogP | 1.08 |
| TPSA | 184.68 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 524.58 |
| LogP ≤ 5 | 1.08 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 8 |