C16H14Cl2N2O4S — CID 2471941
N-[4-(acetylsulfamoyl)phenyl]-2-(3,4-dichlorophenyl)acetamide (PubChem CID 2471941) has the molecular formula C16H14Cl2N2O4S and a molecular weight of 401.27 g/mol. Its IUPAC name is N-[4-(acetylsulfamoyl)phenyl]-2-(3,4-dichlorophenyl)acetamide.
| Compound Name | N-[4-(acetylsulfamoyl)phenyl]-2-(3,4-dichlorophenyl)acetamide |
|---|---|
| PubChem CID | 2471941 |
| Molecular Formula | C16H14Cl2N2O4S |
| Molecular Weight | 401.27 g/mol |
| Exact Mass | 400.01 |
| IUPAC Name | N-[4-(acetylsulfamoyl)phenyl]-2-(3,4-dichlorophenyl)acetamide |
| SMILES | CC(=O)NS(=O)(=O)c1ccc(NC(=O)Cc2ccc(Cl)c(Cl)c2)cc1 |
| InChI | InChI=1S/C16H14Cl2N2O4S/c1-10(21)20-25(23,24)13-5-3-12(4-6-13)19-16(22)9-11-2-7-14(17)15(18)8-11/h2-8H,9H2,1H3,(H,19,22)(H,20,21) |
| InChIKey | VBMDWYAWEVOYNU-UHFFFAOYSA-N |
| XLogP | 3.00 |
| TPSA | 92.34 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 401.27 |
| LogP ≤ 5 | 3.00 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |